C11H14N2O7 — CID 101420388
1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(1-hydroxy-2-oxopropyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 101420388) has the molecular formula C11H14N2O7 and a molecular weight of 286.24 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(1-hydroxy-2-oxopropyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(1-hydroxy-2-oxopropyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101420388 |
| Molecular Formula | C11H14N2O7 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(1-hydroxy-2-oxopropyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(=O)C(O)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H14N2O7/c1-4(14)6(16)9-7(17)8(18)10(20-9)13-3-2-5(15)12-11(13)19/h2-3,6-10,16-18H,1H3,(H,12,15,19)/t6?,7-,8+,9+,10+/m0/s1 |
| InChIKey | CFQUKSCLXGABHP-DEMCRKGTSA-N |
| XLogP | -2.89 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |