C10H13N2Na2O9P — CID 90671478
disodium;1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxy-2-phosphonatoethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 90671478) has the molecular formula C10H13N2Na2O9P and a molecular weight of 382.17 g/mol. Its IUPAC name is disodium;1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxy-2-phosphonatoethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | disodium;1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxy-2-phosphonatoethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90671478 |
| Molecular Formula | C10H13N2Na2O9P |
| Molecular Weight | 382.17 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | disodium;1-[(2R,3R,4R,5S)-3,4-dihydroxy-5-[(1S)-1-hydroxy-2-phosphonatoethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@H]([C@H](O)CP(=O)([O-])[O-])[C@H](O)[C@H]2O)c(=O)[nH]1.[Na+].[Na+] |
| InChI | InChI=1S/C10H15N2O9P.2Na/c13-4(3-22(18,19)20)8-6(15)7(16)9(21-8)12-2-1-5(14)11-10(12)17;;/h1-2,4,6-9,13,15-16H,3H2,(H,11,14,17)(H2,18,19,20);;/q;2*+1/p-2/t4-,6-,7-,8-,9-;;/m1../s1 |
| InChIKey | IFCZTUYJICPCAL-PBFGAJDQSA-L |
| XLogP | -10.56 |
| TPSA | 187.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.17 |
| LogP ≤ 5 | -10.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|