C10H15N3NaO8P — CID 54763529
sodium [(2R)-2-[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-hydroxyphosphinate (PubChem CID 54763529) has the molecular formula C10H15N3NaO8P and a molecular weight of 359.21 g/mol. Its IUPAC name is sodium [(2R)-2-[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-hydroxyphosphinate.
| Compound Name | sodium [(2R)-2-[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 54763529 |
| Molecular Formula | C10H15N3NaO8P |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | sodium [(2R)-2-[(2S,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]-hydroxyphosphinate |
| SMILES | Nc1ccn([C@@H]2O[C@H]([C@@H](O)CP(=O)([O-])O)[C@@H](O)[C@H]2O)c(=O)n1.[Na+] |
| InChI | InChI=1S/C10H16N3O8P.Na/c11-5-1-2-13(10(17)12-5)9-7(16)6(15)8(21-9)4(14)3-22(18,19)20;/h1-2,4,6-9,14-16H,3H2,(H2,11,12,17)(H2,18,19,20);/q;+1/p-1/t4-,6-,7+,8+,9+;/m0./s1 |
| InChIKey | UJWKPTVFHMSVJB-SJMHDAPBSA-M |
| XLogP | -6.64 |
| TPSA | 191.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | -6.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|