C9H15N3O8P+ — CID 176805301
[(2R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-trihydroxyphosphanium (PubChem CID 176805301) has the molecular formula C9H15N3O8P+ and a molecular weight of 324.21 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-trihydroxyphosphanium.
| Compound Name | [(2R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-trihydroxyphosphanium |
|---|---|
| PubChem CID | 176805301 |
| Molecular Formula | C9H15N3O8P+ |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | [(2R,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-trihydroxyphosphanium |
| SMILES | Nc1ccn([C@@H]2O[C@H](CO[P+](O)(O)O)C(O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14,16-18H,3H2,(H-,10,11,15)/p+1/t4-,6?,7+,8-/m1/s1 |
| InChIKey | OTOLHOHXQLGMQK-PDVZPSIWSA-O |
| XLogP | -2.88 |
| TPSA | 180.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|