C9H15N4O6P — CID 22885886
[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxyphosphonamidous acid (PubChem CID 22885886) has the molecular formula C9H15N4O6P and a molecular weight of 306.22 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxyphosphonamidous acid.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxyphosphonamidous acid |
|---|---|
| PubChem CID | 22885886 |
| Molecular Formula | C9H15N4O6P |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxyphosphonamidous acid |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(N)O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H15N4O6P/c10-5-1-2-13(9(16)12-5)8-7(15)6(14)4(19-8)3-18-20(11)17/h1-2,4,6-8,14-15,17H,3,11H2,(H2,10,12,16)/t4-,6-,7-,8-,20?/m1/s1 |
| InChIKey | QMQSWGFCIAYMQY-RORGUDSGSA-N |
| XLogP | -2.36 |
| TPSA | 166.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|