C11H15N2O11P — CID 50942371
2-[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid (PubChem CID 50942371) has the molecular formula C11H15N2O11P and a molecular weight of 382.22 g/mol. Its IUPAC name is 2-[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid.
| Compound Name | 2-[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid |
|---|---|
| PubChem CID | 50942371 |
| Molecular Formula | C11H15N2O11P |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2-[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phosphonoacetic acid |
| SMILES | O=C(O)C(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C11H15N2O11P/c14-5-1-2-13(11(19)12-5)8-7(16)6(15)4(24-8)3-23-10(9(17)18)25(20,21)22/h1-2,4,6-8,10,15-16H,3H2,(H,17,18)(H,12,14,19)(H2,20,21,22)/t4-,6-,7-,8-,10?/m1/s1 |
| InChIKey | ZDQJOISMDODNLK-OYMHBMIISA-N |
| XLogP | -3.24 |
| TPSA | 208.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|