C13H22N3O9P — CID 177440151
[(1S)-4-amino-1-[(2S,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]butyl] dihydrogen phosphate (PubChem CID 177440151) has the molecular formula C13H22N3O9P and a molecular weight of 395.31 g/mol. Its IUPAC name is [(1S)-4-amino-1-[(2S,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]butyl] dihydrogen phosphate.
| Compound Name | [(1S)-4-amino-1-[(2S,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 177440151 |
| Molecular Formula | C13H22N3O9P |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [(1S)-4-amino-1-[(2S,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]butyl] dihydrogen phosphate |
| SMILES | CO[C@@H]1[C@H](O)[C@@H]([C@H](CCCN)OP(=O)(O)O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C13H22N3O9P/c1-23-11-9(18)10(7(3-2-5-14)25-26(20,21)22)24-12(11)16-6-4-8(17)15-13(16)19/h4,6-7,9-12,18H,2-3,5,14H2,1H3,(H,15,17,19)(H2,20,21,22)/t7-,9+,10+,11+,12+/m0/s1 |
| InChIKey | REWKFCXFHBIBJO-FRNCOOQWSA-N |
| XLogP | -1.97 |
| TPSA | 186.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|