C15H21N2O11P2-3 — CID 176803340
[(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-2-(2-phosphonatocyclopropyl)oxolan-3-yl] propan-2-yl phosphate (PubChem CID 176803340) has the molecular formula C15H21N2O11P2-3 and a molecular weight of 467.28 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-2-(2-phosphonatocyclopropyl)oxolan-3-yl] propan-2-yl phosphate.
| Compound Name | [(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-2-(2-phosphonatocyclopropyl)oxolan-3-yl] propan-2-yl phosphate |
|---|---|
| PubChem CID | 176803340 |
| Molecular Formula | C15H21N2O11P2-3 |
| Molecular Weight | 467.28 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | [(2R,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-2-(2-phosphonatocyclopropyl)oxolan-3-yl] propan-2-yl phosphate |
| SMILES | CO[C@H]1C(OP(=O)([O-])OC(C)C)[C@@H](C2CC2P(=O)([O-])[O-])O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C15H24N2O11P2/c1-7(2)27-30(23,24)28-12-11(8-6-9(8)29(20,21)22)26-14(13(12)25-3)17-5-4-10(18)16-15(17)19/h4-5,7-9,11-14H,6H2,1-3H3,(H,23,24)(H,16,18,19)(H2,20,21,22)/p-3/t8?,9?,11-,12?,13+,14-/m1/s1 |
| InChIKey | SXAWLUCAXPQYFC-XCOWOFACSA-K |
| XLogP | -1.97 |
| TPSA | 195.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.28 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|