C15H23N2O10P2- — CID 169205573
[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-2-(2-phosphonocyclopropyl)oxolan-3-yl]oxy-propan-2-ylphosphinate (PubChem CID 169205573) has the molecular formula C15H23N2O10P2- and a molecular weight of 453.30 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-2-(2-phosphonocyclopropyl)oxolan-3-yl]oxy-propan-2-ylphosphinate.
| Compound Name | [(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-2-(2-phosphonocyclopropyl)oxolan-3-yl]oxy-propan-2-ylphosphinate |
|---|---|
| PubChem CID | 169205573 |
| Molecular Formula | C15H23N2O10P2- |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-methoxy-2-(2-phosphonocyclopropyl)oxolan-3-yl]oxy-propan-2-ylphosphinate |
| SMILES | CO[C@H]1[C@@H](OP(=O)([O-])C(C)C)[C@@H](C2CC2P(=O)(O)O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C15H24N2O10P2/c1-7(2)29(23,24)27-12-11(8-6-9(8)28(20,21)22)26-14(13(12)25-3)17-5-4-10(18)16-15(17)19/h4-5,7-9,11-14H,6H2,1-3H3,(H,23,24)(H,16,18,19)(H2,20,21,22)/p-1/t8?,9?,11-,12+,13+,14-/m1/s1 |
| InChIKey | LFCUCZYRACKXTD-GLQDRFAKSA-M |
| XLogP | -0.64 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|