C11H16N2O5 — CID 20822770
1-(3,4-dihydroxy-5-propyloxolan-2-yl)pyrimidine-2,4-dione (PubChem CID 20822770) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is 1-(3,4-dihydroxy-5-propyloxolan-2-yl)pyrimidine-2,4-dione.
| Compound Name | 1-(3,4-dihydroxy-5-propyloxolan-2-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 20822770 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-(3,4-dihydroxy-5-propyloxolan-2-yl)pyrimidine-2,4-dione |
| SMILES | CCCC1OC(n2ccc(=O)[nH]c2=O)C(O)C1O |
| InChI | InChI=1S/C11H16N2O5/c1-2-3-6-8(15)9(16)10(18-6)13-5-4-7(14)12-11(13)17/h4-6,8-10,15-16H,2-3H2,1H3,(H,12,14,17) |
| InChIKey | FYPHHDCPCGJKFV-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |