C15H25IN2O6 — CID 178052003
1-(4-hydroxy-3-methoxy-5-propyloxolan-2-yl)pyrimidine-2,4-dione;propyl hypoiodite (PubChem CID 178052003) has the molecular formula C15H25IN2O6 and a molecular weight of 456.28 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methoxy-5-propyloxolan-2-yl)pyrimidine-2,4-dione;propyl hypoiodite.
| Compound Name | 1-(4-hydroxy-3-methoxy-5-propyloxolan-2-yl)pyrimidine-2,4-dione;propyl hypoiodite |
|---|---|
| PubChem CID | 178052003 |
| Molecular Formula | C15H25IN2O6 |
| Molecular Weight | 456.28 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 1-(4-hydroxy-3-methoxy-5-propyloxolan-2-yl)pyrimidine-2,4-dione;propyl hypoiodite |
| SMILES | CCCC1OC(n2ccc(=O)[nH]c2=O)C(OC)C1O.CCCOI |
| InChI | InChI=1S/C12H18N2O5.C3H7IO/c1-3-4-7-9(16)10(18-2)11(19-7)14-6-5-8(15)13-12(14)17;1-2-3-5-4/h5-7,9-11,16H,3-4H2,1-2H3,(H,13,15,17);2-3H2,1H3 |
| InChIKey | VZPBRKQBAJKBCP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|