C17H28N2O6 — CID 20762853
1-[3-heptoxy-4-hydroxy-5-(2-hydroxyethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 20762853) has the molecular formula C17H28N2O6 and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-[3-heptoxy-4-hydroxy-5-(2-hydroxyethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-heptoxy-4-hydroxy-5-(2-hydroxyethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 20762853 |
| Molecular Formula | C17H28N2O6 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-[3-heptoxy-4-hydroxy-5-(2-hydroxyethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCCCCCCOC1C(O)C(CCO)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C17H28N2O6/c1-2-3-4-5-6-11-24-15-14(22)12(8-10-20)25-16(15)19-9-7-13(21)18-17(19)23/h7,9,12,14-16,20,22H,2-6,8,10-11H2,1H3,(H,18,21,23) |
| InChIKey | RQLYEKVIHCTZRY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|