C15H24N2O5 — CID 121487331
1-[(2R,4S,5R)-3-hexyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 121487331) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-3-hexyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-3-hexyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 121487331 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-[(2R,4S,5R)-3-hexyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCCCCCC1[C@H](n2ccc(=O)[nH]c2=O)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C15H24N2O5/c1-2-3-4-5-6-10-13(20)11(9-18)22-14(10)17-8-7-12(19)16-15(17)21/h7-8,10-11,13-14,18,20H,2-6,9H2,1H3,(H,16,19,21)/t10?,11-,13+,14-/m1/s1 |
| InChIKey | VDIGCDXZIXKCJJ-YHMMTMRJSA-N |
| XLogP | 0.37 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|