C15H24N2O8S — CID 178051976
2-methylpropyl 2-[5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]ethanesulfonate (PubChem CID 178051976) has the molecular formula C15H24N2O8S and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-methylpropyl 2-[5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]ethanesulfonate.
| Compound Name | 2-methylpropyl 2-[5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]ethanesulfonate |
|---|---|
| PubChem CID | 178051976 |
| Molecular Formula | C15H24N2O8S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-methylpropyl 2-[5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methoxyoxolan-2-yl]ethanesulfonate |
| SMILES | COC1C(O)C(CCS(=O)(=O)OCC(C)C)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C15H24N2O8S/c1-9(2)8-24-26(21,22)7-5-10-12(19)13(23-3)14(25-10)17-6-4-11(18)16-15(17)20/h4,6,9-10,12-14,19H,5,7-8H2,1-3H3,(H,16,18,20) |
| InChIKey | VWJIGZWXVVUVGU-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|