C39H68N2O6 — CID 134223463
1-[3-prop-2-ynoxy-5-(tetradecan-7-yloxymethyl)-4-tridecan-6-yloxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 134223463) has the molecular formula C39H68N2O6 and a molecular weight of 660.98 g/mol. Its IUPAC name is 1-[3-prop-2-ynoxy-5-(tetradecan-7-yloxymethyl)-4-tridecan-6-yloxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-prop-2-ynoxy-5-(tetradecan-7-yloxymethyl)-4-tridecan-6-yloxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134223463 |
| Molecular Formula | C39H68N2O6 |
| Molecular Weight | 660.98 g/mol |
| Exact Mass | 660.51 |
| IUPAC Name | 1-[3-prop-2-ynoxy-5-(tetradecan-7-yloxymethyl)-4-tridecan-6-yloxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#CCOC1C(OC(CCCCC)CCCCCCC)C(COC(CCCCCC)CCCCCCC)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C39H68N2O6/c1-6-11-15-18-22-25-32(24-21-17-13-8-3)45-31-34-36(46-33(26-20-14-9-4)27-23-19-16-12-7-2)37(44-30-10-5)38(47-34)41-29-28-35(42)40-39(41)43/h5,28-29,32-34,36-38H,6-9,11-27,30-31H2,1-4H3,(H,40,42,43) |
| InChIKey | LOYOKZVSJVVONU-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.98 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|