C19H31FN2O7 — CID 87167984
1-[(2R,3R,4S,5R)-5-(5-fluorodecylperoxymethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 87167984) has the molecular formula C19H31FN2O7 and a molecular weight of 418.46 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-(5-fluorodecylperoxymethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-(5-fluorodecylperoxymethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87167984 |
| Molecular Formula | C19H31FN2O7 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-(5-fluorodecylperoxymethyl)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCCCCC(F)CCCCOOC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H31FN2O7/c1-2-3-4-7-13(20)8-5-6-11-27-28-12-14-16(24)17(25)18(29-14)22-10-9-15(23)21-19(22)26/h9-10,13-14,16-18,24-25H,2-8,11-12H2,1H3,(H,21,23,26)/t13?,14-,16-,17-,18-/m1/s1 |
| InChIKey | PLQUUAQEPKAWCI-RXWMHYPFSA-N |
| XLogP | 1.19 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|