C20H32N2O8Si — CID 123630943
ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-2-yl]-3-oxopropanoate (PubChem CID 123630943) has the molecular formula C20H32N2O8Si and a molecular weight of 456.57 g/mol. Its IUPAC name is ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-2-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-2-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 123630943 |
| Molecular Formula | C20H32N2O8Si |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-2-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)C1OC(n2ccc(=O)[nH]c2=O)C(OC)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32N2O8Si/c1-8-28-14(25)11-12(23)15-16(30-31(6,7)20(2,3)4)17(27-5)18(29-15)22-10-9-13(24)21-19(22)26/h9-10,15-18H,8,11H2,1-7H3,(H,21,24,26) |
| InChIKey | GCTCOEVKMINRGC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|