C26H45N3O7Si2 — CID 57337334
(2S,3R)-3-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-N-prop-2-enyloxirane-2-carboxamide (PubChem CID 57337334) has the molecular formula C26H45N3O7Si2 and a molecular weight of 567.83 g/mol. Its IUPAC name is (2S,3R)-3-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-N-prop-2-enyloxirane-2-carboxamide.
| Compound Name | (2S,3R)-3-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-N-prop-2-enyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 57337334 |
| Molecular Formula | C26H45N3O7Si2 |
| Molecular Weight | 567.83 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | (2S,3R)-3-[(2R,3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-N-prop-2-enyloxirane-2-carboxamide |
| SMILES | C=CCNC(=O)[C@H]1O[C@@H]1[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H45N3O7Si2/c1-12-14-27-22(31)20-18(33-20)17-19(35-37(8,9)25(2,3)4)21(36-38(10,11)26(5,6)7)23(34-17)29-15-13-16(30)28-24(29)32/h12-13,15,17-21,23H,1,14H2,2-11H3,(H,27,31)(H,28,30,32)/t17-,18-,19-,20+,21-,23-/m1/s1 |
| InChIKey | ROCLMUSPEZLSJJ-IJOIENHYSA-N |
| XLogP | 3.28 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.83 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|