C30H49N5O8Si2 — CID 135484744
(Z)-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl-[(4-ethoxycarbonylphenyl)hydrazinylidene]-oxidoazanium (PubChem CID 135484744) has the molecular formula C30H49N5O8Si2 and a molecular weight of 663.92 g/mol. Its IUPAC name is (Z)-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl-[(4-ethoxycarbonylphenyl)hydrazinylidene]-oxidoazanium.
| Compound Name | (Z)-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl-[(4-ethoxycarbonylphenyl)hydrazinylidene]-oxidoazanium |
|---|---|
| PubChem CID | 135484744 |
| Molecular Formula | C30H49N5O8Si2 |
| Molecular Weight | 663.92 g/mol |
| Exact Mass | 663.31 |
| IUPAC Name | (Z)-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl-[(4-ethoxycarbonylphenyl)hydrazinylidene]-oxidoazanium |
| SMILES | CCOC(=O)c1ccc(N/N=[N+](\[O-])CC2OC(n3ccc(=O)[nH]c3=O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H49N5O8Si2/c1-12-40-27(37)20-13-15-21(16-14-20)32-33-35(39)19-22-24(42-44(8,9)29(2,3)4)25(43-45(10,11)30(5,6)7)26(41-22)34-18-17-23(36)31-28(34)38/h13-18,22,24-26,32H,12,19H2,1-11H3,(H,31,36,38)/b35-33- |
| InChIKey | HYWQGFGEWCAORZ-OAPYJULQSA-N |
| XLogP | 5.38 |
| TPSA | 159.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.92 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|