C19H31N5O6Si — CID 10694982
ethyl 2-[(2S,3R,4R,5R)-2-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetate (PubChem CID 10694982) has the molecular formula C19H31N5O6Si and a molecular weight of 453.57 g/mol. Its IUPAC name is ethyl 2-[(2S,3R,4R,5R)-2-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetate.
| Compound Name | ethyl 2-[(2S,3R,4R,5R)-2-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetate |
|---|---|
| PubChem CID | 10694982 |
| Molecular Formula | C19H31N5O6Si |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | ethyl 2-[(2S,3R,4R,5R)-2-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CN=[N+]=[N-] |
| InChI | InChI=1S/C19H31N5O6Si/c1-7-28-15(26)10-12-13(11-21-23-20)29-17(24-9-8-14(25)22-18(24)27)16(12)30-31(5,6)19(2,3)4/h8-9,12-13,16-17H,7,10-11H2,1-6H3,(H,22,25,27)/t12-,13-,16-,17-/m1/s1 |
| InChIKey | KVVQCOZTOWOBGB-BQGCOEIASA-N |
| XLogP | 2.70 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|