C17H27N5O6Si — CID 11177774
2-[(2S,3R,4R,5R)-2-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetic acid (PubChem CID 11177774) has the molecular formula C17H27N5O6Si and a molecular weight of 425.52 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R)-2-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetic acid.
| Compound Name | 2-[(2S,3R,4R,5R)-2-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetic acid |
|---|---|
| PubChem CID | 11177774 |
| Molecular Formula | C17H27N5O6Si |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 2-[(2S,3R,4R,5R)-2-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](CC(=O)O)[C@@H](CN=[N+]=[N-])O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C17H27N5O6Si/c1-17(2,3)29(4,5)28-14-10(8-13(24)25)11(9-19-21-18)27-15(14)22-7-6-12(23)20-16(22)26/h6-7,10-11,14-15H,8-9H2,1-5H3,(H,24,25)(H,20,23,26)/t10-,11-,14-,15-/m1/s1 |
| InChIKey | AVFYEJOXHMKDBF-YIKOMLBNSA-N |
| XLogP | 2.23 |
| TPSA | 159.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|