C18H32N2O6SSi — CID 58871641
1-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-(2-methylsulfanylethoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 58871641) has the molecular formula C18H32N2O6SSi and a molecular weight of 432.62 g/mol. Its IUPAC name is 1-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-(2-methylsulfanylethoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-(2-methylsulfanylethoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58871641 |
| Molecular Formula | C18H32N2O6SSi |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-[(2R,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5-(2-methylsulfanylethoxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CSCCOC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](O[Si](C)(C)C(C)(C)C)C1O |
| InChI | InChI=1S/C18H32N2O6SSi/c1-18(2,3)28(5,6)26-15-14(22)12(11-24-9-10-27-4)25-16(15)20-8-7-13(21)19-17(20)23/h7-8,12,14-16,22H,9-11H2,1-6H3,(H,19,21,23)/t12-,14?,15+,16-/m1/s1 |
| InChIKey | XQEDOOWEIKRGOM-QSBXLFSZSA-N |
| XLogP | 1.56 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|