C15H25ClN2O5Si — CID 11783743
1-[(2S,3S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 11783743) has the molecular formula C15H25ClN2O5Si and a molecular weight of 376.91 g/mol. Its IUPAC name is 1-[(2S,3S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,3S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11783743 |
| Molecular Formula | C15H25ClN2O5Si |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1-[(2S,3S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@H](n2ccc(=O)[nH]c2=O)[C@@H](Cl)[C@H]1O |
| InChI | InChI=1S/C15H25ClN2O5Si/c1-15(2,3)24(4,5)22-8-9-12(20)11(16)13(23-9)18-7-6-10(19)17-14(18)21/h6-7,9,11-13,20H,8H2,1-5H3,(H,17,19,21)/t9-,11-,12-,13-/m0/s1 |
| InChIKey | RONXHYRNRSBPFK-BQUFFADESA-N |
| XLogP | 1.42 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|