C17H27N3O7Si — CID 102222535
(2R,3S,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,4-dioxopyrimidin-1-yl)-3,4,5-trihydroxyoxane-3-carbonitrile (PubChem CID 102222535) has the molecular formula C17H27N3O7Si and a molecular weight of 413.50 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,4-dioxopyrimidin-1-yl)-3,4,5-trihydroxyoxane-3-carbonitrile.
| Compound Name | (2R,3S,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,4-dioxopyrimidin-1-yl)-3,4,5-trihydroxyoxane-3-carbonitrile |
|---|---|
| PubChem CID | 102222535 |
| Molecular Formula | C17H27N3O7Si |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | (2R,3S,4S,5R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(2,4-dioxopyrimidin-1-yl)-3,4,5-trihydroxyoxane-3-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@](O)(C#N)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H27N3O7Si/c1-16(2,3)28(4,5)26-8-10-12(22)13(23)17(25,9-18)14(27-10)20-7-6-11(21)19-15(20)24/h6-7,10,12-14,22-23,25H,8H2,1-5H3,(H,19,21,24)/t10-,12+,13+,14-,17+/m1/s1 |
| InChIKey | DFXICRKRJQCJPM-OMKXWNATSA-N |
| XLogP | -0.57 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|