C23H39N3O5Si2 — CID 5469825
(2E)-2-[4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-ylidene]acetonitrile (PubChem CID 5469825) has the molecular formula C23H39N3O5Si2 and a molecular weight of 493.75 g/mol. Its IUPAC name is (2E)-2-[4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-ylidene]acetonitrile.
| Compound Name | (2E)-2-[4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-ylidene]acetonitrile |
|---|---|
| PubChem CID | 5469825 |
| Molecular Formula | C23H39N3O5Si2 |
| Molecular Weight | 493.75 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | (2E)-2-[4-[tert-butyl(dimethyl)silyl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-ylidene]acetonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(n2ccc(=O)[nH]c2=O)C(O[Si](C)(C)C(C)(C)C)/C1=C/C#N |
| InChI | InChI=1S/C23H39N3O5Si2/c1-22(2,3)32(7,8)29-15-17-16(11-13-24)19(31-33(9,10)23(4,5)6)20(30-17)26-14-12-18(27)25-21(26)28/h11-12,14,17,19-20H,15H2,1-10H3,(H,25,27,28)/b16-11+ |
| InChIKey | BKTNMVOFLGEWND-LFIBNONCSA-N |
| XLogP | 4.30 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.75 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|