C15H25N3O6Si — CID 10571270
1-[(2R,3R,4E,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyimino-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10571270) has the molecular formula C15H25N3O6Si and a molecular weight of 371.47 g/mol. Its IUPAC name is 1-[(2R,3R,4E,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyimino-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4E,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyimino-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10571270 |
| Molecular Formula | C15H25N3O6Si |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-[(2R,3R,4E,5S)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxyimino-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1/C(=N/O)[C@@H](CO)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C15H25N3O6Si/c1-15(2,3)25(4,5)24-12-11(17-22)9(8-19)23-13(12)18-7-6-10(20)16-14(18)21/h6-7,9,12-13,19,22H,8H2,1-5H3,(H,16,20,21)/b17-11+/t9-,12-,13-/m1/s1 |
| InChIKey | XWFQETWCDVUETI-PHDFCQBGSA-N |
| XLogP | 0.65 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|