C10H12FN3O5 — CID 102453062
1-[(2R,3R,4Z,5S)-3-fluoro-5-(hydroxymethyl)-4-methoxyiminooxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 102453062) has the molecular formula C10H12FN3O5 and a molecular weight of 273.22 g/mol. Its IUPAC name is 1-[(2R,3R,4Z,5S)-3-fluoro-5-(hydroxymethyl)-4-methoxyiminooxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4Z,5S)-3-fluoro-5-(hydroxymethyl)-4-methoxyiminooxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102453062 |
| Molecular Formula | C10H12FN3O5 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 1-[(2R,3R,4Z,5S)-3-fluoro-5-(hydroxymethyl)-4-methoxyiminooxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CO/N=C1\[C@@H](F)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C10H12FN3O5/c1-18-13-8-5(4-15)19-9(7(8)11)14-3-2-6(16)12-10(14)17/h2-3,5,7,9,15H,4H2,1H3,(H,12,16,17)/b13-8-/t5-,7-,9-/m1/s1 |
| InChIKey | ISFRAKXZUIHHPM-OSCBFZQFSA-N |
| XLogP | -1.23 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|