C21H38Br2N2O5Si2 — CID 141489547
1-[(2R,4R,5R)-3,3-dibromo-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 141489547) has the molecular formula C21H38Br2N2O5Si2 and a molecular weight of 614.52 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-3,3-dibromo-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4R,5R)-3,3-dibromo-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 141489547 |
| Molecular Formula | C21H38Br2N2O5Si2 |
| Molecular Weight | 614.52 g/mol |
| Exact Mass | 612.07 |
| IUPAC Name | 1-[(2R,4R,5R)-3,3-dibromo-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C(Br)(Br)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38Br2N2O5Si2/c1-19(2,3)31(7,8)28-13-14-16(30-32(9,10)20(4,5)6)21(22,23)17(29-14)25-12-11-15(26)24-18(25)27/h11-12,14,16-17H,13H2,1-10H3,(H,24,26,27)/t14-,16-,17-/m1/s1 |
| InChIKey | XHACDFMGCUJUSL-DJIMGWMZSA-N |
| XLogP | 5.33 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|