C19H31FN2O5Si — CID 140866833
1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-3-methyl-4-prop-2-enoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 140866833) has the molecular formula C19H31FN2O5Si and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-3-methyl-4-prop-2-enoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-3-methyl-4-prop-2-enoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140866833 |
| Molecular Formula | C19H31FN2O5Si |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-3-methyl-4-prop-2-enoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=CCO[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](n2ccc(=O)[nH]c2=O)[C@]1(C)F |
| InChI | InChI=1S/C19H31FN2O5Si/c1-8-11-25-15-13(12-26-28(6,7)18(2,3)4)27-16(19(15,5)20)22-10-9-14(23)21-17(22)24/h8-10,13,15-16H,1,11-12H2,2-7H3,(H,21,23,24)/t13-,15-,16-,19-/m1/s1 |
| InChIKey | MQLTZEQZYMOGAJ-NVQRDWNXSA-N |
| XLogP | 2.76 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|