C13H17FN2O5 — CID 122579815
1-[(2R,3R,4R,5R)-3-fluoro-5-(hydroxymethyl)-3-methyl-4-prop-2-enoxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 122579815) has the molecular formula C13H17FN2O5 and a molecular weight of 300.29 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3-fluoro-5-(hydroxymethyl)-3-methyl-4-prop-2-enoxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-3-fluoro-5-(hydroxymethyl)-3-methyl-4-prop-2-enoxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 122579815 |
| Molecular Formula | C13H17FN2O5 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3-fluoro-5-(hydroxymethyl)-3-methyl-4-prop-2-enoxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=CCO[C@@H]1[C@@H](CO)O[C@@H](n2ccc(=O)[nH]c2=O)[C@]1(C)F |
| InChI | InChI=1S/C13H17FN2O5/c1-3-6-20-10-8(7-17)21-11(13(10,2)14)16-5-4-9(18)15-12(16)19/h3-5,8,10-11,17H,1,6-7H2,2H3,(H,15,18,19)/t8-,10-,11-,13-/m1/s1 |
| InChIKey | QHMFAKKBBJSUNM-UORFTKCHSA-N |
| XLogP | -0.27 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|