C12H13FN2O5 — CID 121314821
(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyl-2-(2-oxoethyl)oxolane-3-carbaldehyde (PubChem CID 121314821) has the molecular formula C12H13FN2O5 and a molecular weight of 284.24 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyl-2-(2-oxoethyl)oxolane-3-carbaldehyde.
| Compound Name | (2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyl-2-(2-oxoethyl)oxolane-3-carbaldehyde |
|---|---|
| PubChem CID | 121314821 |
| Molecular Formula | C12H13FN2O5 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-4-methyl-2-(2-oxoethyl)oxolane-3-carbaldehyde |
| SMILES | C[C@@]1(F)[C@H](C=O)[C@@H](CC=O)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H13FN2O5/c1-12(13)7(6-17)8(3-5-16)20-10(12)15-4-2-9(18)14-11(15)19/h2,4-8,10H,3H2,1H3,(H,14,18,19)/t7-,8-,10-,12-/m1/s1 |
| InChIKey | SEKNSBYHSLHGMK-FWSPBBIJSA-N |
| XLogP | -0.43 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|