C10H10F2N2O4 — CID 118594364
(2S,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4,4-difluoro-3-methyloxolane-2-carbaldehyde (PubChem CID 118594364) has the molecular formula C10H10F2N2O4 and a molecular weight of 260.20 g/mol. Its IUPAC name is (2S,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4,4-difluoro-3-methyloxolane-2-carbaldehyde.
| Compound Name | (2S,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4,4-difluoro-3-methyloxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 118594364 |
| Molecular Formula | C10H10F2N2O4 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | (2S,3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4,4-difluoro-3-methyloxolane-2-carbaldehyde |
| SMILES | C[C@@H]1[C@@H](C=O)O[C@@H](n2ccc(=O)[nH]c2=O)C1(F)F |
| InChI | InChI=1S/C10H10F2N2O4/c1-5-6(4-15)18-8(10(5,11)12)14-3-2-7(16)13-9(14)17/h2-6,8H,1H3,(H,13,16,17)/t5-,6-,8-/m1/s1 |
| InChIKey | XKZWQDOIISMYGY-ATRFCDNQSA-N |
| XLogP | -0.10 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|