C10H13FN2O6 — CID 163855944
1-[(5S)-5-(dihydroxymethyl)-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 163855944) has the molecular formula C10H13FN2O6 and a molecular weight of 276.22 g/mol. Its IUPAC name is 1-[(5S)-5-(dihydroxymethyl)-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(5S)-5-(dihydroxymethyl)-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163855944 |
| Molecular Formula | C10H13FN2O6 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-[(5S)-5-(dihydroxymethyl)-3-fluoro-4-hydroxy-3-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC1(F)C(O)[C@@H](C(O)O)OC1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13FN2O6/c1-10(11)6(15)5(7(16)17)19-8(10)13-3-2-4(14)12-9(13)18/h2-3,5-8,15-17H,1H3,(H,12,14,18)/t5-,6?,8?,10?/m0/s1 |
| InChIKey | OYHRTWXOVYDQLS-YUFURYARSA-N |
| XLogP | -2.17 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|