C12H14ClN3O5 — CID 167374947
1-[(2R,3R,5R)-3-amino-3-(2-chloroethynyl)-4-hydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 167374947) has the molecular formula C12H14ClN3O5 and a molecular weight of 315.71 g/mol. Its IUPAC name is 1-[(2R,3R,5R)-3-amino-3-(2-chloroethynyl)-4-hydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,5R)-3-amino-3-(2-chloroethynyl)-4-hydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 167374947 |
| Molecular Formula | C12H14ClN3O5 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 1-[(2R,3R,5R)-3-amino-3-(2-chloroethynyl)-4-hydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[C@@H](O)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@](N)(C#CCl)C1O |
| InChI | InChI=1S/C12H14ClN3O5/c1-6(17)8-9(19)12(14,3-4-13)10(21-8)16-5-2-7(18)15-11(16)20/h2,5-6,8-10,17,19H,14H2,1H3,(H,15,18,20)/t6-,8-,9?,10-,12-/m1/s1 |
| InChIKey | LDYUORDHTPDCIV-ZTEIULIGSA-N |
| XLogP | -1.93 |
| TPSA | 130.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|