C11H11ClFN3O5 — CID 167374890
2-[(2R,3R,5R)-3-(2-chloroethynyl)-3-fluoro-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,2,4-triazine-3,5-dione (PubChem CID 167374890) has the molecular formula C11H11ClFN3O5 and a molecular weight of 319.68 g/mol. Its IUPAC name is 2-[(2R,3R,5R)-3-(2-chloroethynyl)-3-fluoro-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[(2R,3R,5R)-3-(2-chloroethynyl)-3-fluoro-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 167374890 |
| Molecular Formula | C11H11ClFN3O5 |
| Molecular Weight | 319.68 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-[(2R,3R,5R)-3-(2-chloroethynyl)-3-fluoro-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,2,4-triazine-3,5-dione |
| SMILES | C[C@H](O)[C@H]1O[C@@H](n2ncc(=O)[nH]c2=O)[C@@](F)(C#CCl)C1O |
| InChI | InChI=1S/C11H11ClFN3O5/c1-5(17)7-8(19)11(13,2-3-12)9(21-7)16-10(20)15-6(18)4-14-16/h4-5,7-9,17,19H,1H3,(H,15,18,20)/t5-,7+,8?,9+,11+/m0/s1 |
| InChIKey | RQDSULFABSRRGG-JTHUDOHNSA-N |
| XLogP | -1.52 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.68 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|