C11H13ClN4O5 — CID 167374926
1-[(2R,3R,5R)-3-amino-3-(2-chloroethynyl)-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,3,5-triazine-2,4-dione (PubChem CID 167374926) has the molecular formula C11H13ClN4O5 and a molecular weight of 316.70 g/mol. Its IUPAC name is 1-[(2R,3R,5R)-3-amino-3-(2-chloroethynyl)-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,3,5-triazine-2,4-dione.
| Compound Name | 1-[(2R,3R,5R)-3-amino-3-(2-chloroethynyl)-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 167374926 |
| Molecular Formula | C11H13ClN4O5 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1-[(2R,3R,5R)-3-amino-3-(2-chloroethynyl)-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,3,5-triazine-2,4-dione |
| SMILES | C[C@H](O)[C@H]1O[C@@H](n2cnc(=O)[nH]c2=O)[C@@](N)(C#CCl)C1O |
| InChI | InChI=1S/C11H13ClN4O5/c1-5(17)6-7(18)11(13,2-3-12)8(21-6)16-4-14-9(19)15-10(16)20/h4-8,17-18H,13H2,1H3,(H,15,19,20)/t5-,6+,7?,8+,11+/m0/s1 |
| InChIKey | PDVOMSVIQMOPPG-MEWOPBGUSA-N |
| XLogP | -2.53 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|