C12H16N4O4 — CID 145393136
4-amino-1-[(2R,5R)-3-amino-3-ethynyl-4-hydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]pyrimidin-2-one (PubChem CID 145393136) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-amino-1-[(2R,5R)-3-amino-3-ethynyl-4-hydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,5R)-3-amino-3-ethynyl-4-hydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 145393136 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-amino-1-[(2R,5R)-3-amino-3-ethynyl-4-hydroxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]pyrimidin-2-one |
| SMILES | C#CC1(N)C(O)[C@@H]([C@@H](C)O)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C12H16N4O4/c1-3-12(14)9(18)8(6(2)17)20-10(12)16-5-4-7(13)15-11(16)19/h1,4-6,8-10,17-18H,14H2,2H3,(H2,13,15,19)/t6-,8-,9?,10-,12?/m1/s1 |
| InChIKey | ROMNXLMKPQBLFB-PQOWNFLDSA-N |
| XLogP | -2.20 |
| TPSA | 136.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|