C12H15FN4O4 — CID 145393139
4-amino-1-[(4R)-3-amino-3-(3-fluoroprop-1-ynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (PubChem CID 145393139) has the molecular formula C12H15FN4O4 and a molecular weight of 298.27 g/mol. Its IUPAC name is 4-amino-1-[(4R)-3-amino-3-(3-fluoroprop-1-ynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(4R)-3-amino-3-(3-fluoroprop-1-ynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 145393139 |
| Molecular Formula | C12H15FN4O4 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-amino-1-[(4R)-3-amino-3-(3-fluoroprop-1-ynyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| SMILES | Nc1ccn(C2OC(CO)[C@H](O)C2(N)C#CCF)c(=O)n1 |
| InChI | InChI=1S/C12H15FN4O4/c13-4-1-3-12(15)9(19)7(6-18)21-10(12)17-5-2-8(14)16-11(17)20/h2,5,7,9-10,18-19H,4,6,15H2,(H2,14,16,20)/t7?,9-,10?,12?/m0/s1 |
| InChIKey | ZKDTYCZCHRRQDT-XZPLEGQPSA-N |
| XLogP | -2.25 |
| TPSA | 136.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|