C10H12N4O5 — CID 22875357
(2R,3S,4R,5R)-2-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-3-carbonitrile (PubChem CID 22875357) has the molecular formula C10H12N4O5 and a molecular weight of 268.23 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-3-carbonitrile.
| Compound Name | (2R,3S,4R,5R)-2-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-3-carbonitrile |
|---|---|
| PubChem CID | 22875357 |
| Molecular Formula | C10H12N4O5 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (2R,3S,4R,5R)-2-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-3-carbonitrile |
| SMILES | N#C[C@]1(O)[C@H](O)[C@@H](CO)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C10H12N4O5/c11-4-10(18)7(16)5(3-15)19-8(10)14-2-1-6(12)13-9(14)17/h1-2,5,7-8,15-16,18H,3H2,(H2,12,13,17)/t5-,7-,8-,10+/m1/s1 |
| InChIKey | YSTMIXFLYTYDTI-UZRKRJFESA-N |
| XLogP | -2.67 |
| TPSA | 154.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|