C11H14N4O6 — CID 56930499
(2R,3R,4S,5R,6R)-2-(4-amino-2-oxopyrimidin-1-yl)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-4-carbonitrile (PubChem CID 56930499) has the molecular formula C11H14N4O6 and a molecular weight of 298.26 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(4-amino-2-oxopyrimidin-1-yl)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-4-carbonitrile.
| Compound Name | (2R,3R,4S,5R,6R)-2-(4-amino-2-oxopyrimidin-1-yl)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-4-carbonitrile |
|---|---|
| PubChem CID | 56930499 |
| Molecular Formula | C11H14N4O6 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(4-amino-2-oxopyrimidin-1-yl)-3,4,5-trihydroxy-6-(hydroxymethyl)oxane-4-carbonitrile |
| SMILES | N#C[C@]1(O)[C@H](O)[C@@H](CO)O[C@@H](n2ccc(N)nc2=O)[C@@H]1O |
| InChI | InChI=1S/C11H14N4O6/c12-4-11(20)7(17)5(3-16)21-9(8(11)18)15-2-1-6(13)14-10(15)19/h1-2,5,7-9,16-18,20H,3H2,(H2,13,14,19)/t5-,7-,8+,9-,11+/m1/s1 |
| InChIKey | LGKSGCKKVYAHDQ-QPLYKKBVSA-N |
| XLogP | -3.31 |
| TPSA | 174.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|