C11H13FN4O4 — CID 145393404
5-amino-2-[(2R,5R)-3-ethynyl-3-fluoro-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,2,4-triazin-3-one (PubChem CID 145393404) has the molecular formula C11H13FN4O4 and a molecular weight of 284.25 g/mol. Its IUPAC name is 5-amino-2-[(2R,5R)-3-ethynyl-3-fluoro-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,2,4-triazin-3-one.
| Compound Name | 5-amino-2-[(2R,5R)-3-ethynyl-3-fluoro-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 145393404 |
| Molecular Formula | C11H13FN4O4 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 5-amino-2-[(2R,5R)-3-ethynyl-3-fluoro-4-hydroxy-5-[(1S)-1-hydroxyethyl]oxolan-2-yl]-1,2,4-triazin-3-one |
| SMILES | C#CC1(F)C(O)[C@@H]([C@H](C)O)O[C@H]1n1ncc(N)nc1=O |
| InChI | InChI=1S/C11H13FN4O4/c1-3-11(12)8(18)7(5(2)17)20-9(11)16-10(19)15-6(13)4-14-16/h1,4-5,7-9,17-18H,2H3,(H2,13,15,19)/t5-,7+,8?,9+,11?/m0/s1 |
| InChIKey | HKNWNPONRDZTQY-OJTBLQCCSA-N |
| XLogP | -1.80 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|