C10H17ClFN4O13P3 — CID 130425896
[[(1R)-1-[(2S,4R,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-4-chloro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 130425896) has the molecular formula C10H17ClFN4O13P3 and a molecular weight of 548.63 g/mol. Its IUPAC name is [[(1R)-1-[(2S,4R,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-4-chloro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R)-1-[(2S,4R,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-4-chloro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 130425896 |
| Molecular Formula | C10H17ClFN4O13P3 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 547.97 |
| IUPAC Name | [[(1R)-1-[(2S,4R,5R)-5-(5-amino-3-oxo-1,2,4-triazin-2-yl)-4-chloro-4-(fluoromethyl)-3-hydroxyoxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@H](OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1O[C@@H](n2ncc(N)nc2=O)[C@@](Cl)(CF)C1O |
| InChI | InChI=1S/C10H17ClFN4O13P3/c1-4(27-31(22,23)29-32(24,25)28-30(19,20)21)6-7(17)10(11,3-12)8(26-6)16-9(18)15-5(13)2-14-16/h2,4,6-8,17H,3H2,1H3,(H,22,23)(H,24,25)(H2,13,15,18)(H2,19,20,21)/t4-,6-,7?,8-,10-/m1/s1 |
| InChIKey | XCVXJNLEGRSVBQ-NPCKHQLYSA-N |
| XLogP | -0.84 |
| TPSA | 263.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|