C13H18F2N3O13P3 — CID 129281238
[[(1S)-1-[(2S,3S,4R,5R)-5-(4-amino-6-ethynyl-5-fluoro-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 129281238) has the molecular formula C13H18F2N3O13P3 and a molecular weight of 555.21 g/mol. Its IUPAC name is [[(1S)-1-[(2S,3S,4R,5R)-5-(4-amino-6-ethynyl-5-fluoro-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1S)-1-[(2S,3S,4R,5R)-5-(4-amino-6-ethynyl-5-fluoro-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 129281238 |
| Molecular Formula | C13H18F2N3O13P3 |
| Molecular Weight | 555.21 g/mol |
| Exact Mass | 555.00 |
| IUPAC Name | [[(1S)-1-[(2S,3S,4R,5R)-5-(4-amino-6-ethynyl-5-fluoro-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#Cc1c(F)c(N)nc(=O)n1[C@@H]1O[C@H]([C@H](C)OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C13H18F2N3O13P3/c1-4-6-7(14)10(16)17-12(20)18(6)11-13(3,15)9(19)8(28-11)5(2)29-33(24,25)31-34(26,27)30-32(21,22)23/h1,5,8-9,11,19H,2-3H3,(H,24,25)(H,26,27)(H2,16,17,20)(H2,21,22,23)/t5-,8+,9-,11+,13+/m0/s1 |
| InChIKey | PYGGUBAKWCMOAT-STOIPPTESA-N |
| XLogP | -0.34 |
| TPSA | 250.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.21 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|