C12H18ClN4O13P3 — CID 153183772
[[(1S)-1-[(2S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-4-chloro-4-ethynyl-3-(hydroxymethyl)oxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 153183772) has the molecular formula C12H18ClN4O13P3 and a molecular weight of 554.67 g/mol. Its IUPAC name is [[(1S)-1-[(2S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-4-chloro-4-ethynyl-3-(hydroxymethyl)oxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1S)-1-[(2S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-4-chloro-4-ethynyl-3-(hydroxymethyl)oxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 153183772 |
| Molecular Formula | C12H18ClN4O13P3 |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 553.98 |
| IUPAC Name | [[(1S)-1-[(2S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-4-chloro-4-ethynyl-3-(hydroxymethyl)oxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#CC1(Cl)C(CO)[C@@H]([C@H](C)OP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc(N)nc1=O |
| InChI | InChI=1S/C12H18ClN4O13P3/c1-3-12(13)7(4-18)8(27-9(12)17-5-15-10(14)16-11(17)19)6(2)28-32(23,24)30-33(25,26)29-31(20,21)22/h1,5-9,18H,4H2,2H3,(H,23,24)(H,25,26)(H2,14,16,19)(H2,20,21,22)/t6-,7?,8+,9+,12?/m0/s1 |
| InChIKey | WGRHRTZZGQOYEV-SLBCWCOVSA-N |
| XLogP | -0.93 |
| TPSA | 263.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|