C10H17F2N4O13P3 — CID 129281119
[1-[(2S,4R,5R)-5-(5-amino-6-fluoro-3-oxo-1,2,4-triazin-2-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]ethoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 129281119) has the molecular formula C10H17F2N4O13P3 and a molecular weight of 532.18 g/mol. Its IUPAC name is [1-[(2S,4R,5R)-5-(5-amino-6-fluoro-3-oxo-1,2,4-triazin-2-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]ethoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [1-[(2S,4R,5R)-5-(5-amino-6-fluoro-3-oxo-1,2,4-triazin-2-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]ethoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 129281119 |
| Molecular Formula | C10H17F2N4O13P3 |
| Molecular Weight | 532.18 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | [1-[(2S,4R,5R)-5-(5-amino-6-fluoro-3-oxo-1,2,4-triazin-2-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]ethoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1O[C@@H](n2nc(F)c(N)nc2=O)[C@](C)(F)C1O |
| InChI | InChI=1S/C10H17F2N4O13P3/c1-3(27-31(22,23)29-32(24,25)28-30(19,20)21)4-5(17)10(2,12)8(26-4)16-9(18)14-7(13)6(11)15-16/h3-5,8,17H,1-2H3,(H,22,23)(H,24,25)(H2,13,14,18)(H2,19,20,21)/t3?,4-,5?,8-,10-/m1/s1 |
| InChIKey | WJPCOUOMSPKLCF-WVQKQNSWSA-N |
| XLogP | -0.92 |
| TPSA | 263.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.18 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|