C14H19N4O14P3 — CID 163620348
[[(1S)-1-[(2S,3S,5R)-4-ethynyl-3,4-dihydroxy-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 163620348) has the molecular formula C14H19N4O14P3 and a molecular weight of 560.24 g/mol. Its IUPAC name is [[(1S)-1-[(2S,3S,5R)-4-ethynyl-3,4-dihydroxy-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1S)-1-[(2S,3S,5R)-4-ethynyl-3,4-dihydroxy-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 163620348 |
| Molecular Formula | C14H19N4O14P3 |
| Molecular Weight | 560.24 g/mol |
| Exact Mass | 560.01 |
| IUPAC Name | [[(1S)-1-[(2S,3S,5R)-4-ethynyl-3,4-dihydroxy-5-(2-methyl-6-oxo-1H-purin-9-yl)oxolan-2-yl]ethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C#CC1(O)[C@@H](O)[C@@H]([C@H](C)OP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc2c(=O)[nH]c(C)nc21 |
| InChI | InChI=1S/C14H19N4O14P3/c1-4-14(21)10(19)9(6(2)30-34(25,26)32-35(27,28)31-33(22,23)24)29-13(14)18-5-15-8-11(18)16-7(3)17-12(8)20/h1,5-6,9-10,13,19,21H,2-3H3,(H,25,26)(H,27,28)(H,16,17,20)(H2,22,23,24)/t6-,9+,10-,13+,14?/m0/s1 |
| InChIKey | BZKBLJFCYGQPJD-BVQNGOFYSA-N |
| XLogP | -1.22 |
| TPSA | 273.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.24 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|