C16H25N4O14P3 — CID 136996904
[[(3aS,4R,6R)-2,2-diethyl-4-(2-methyl-6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 136996904) has the molecular formula C16H25N4O14P3 and a molecular weight of 590.31 g/mol. Its IUPAC name is [[(3aS,4R,6R)-2,2-diethyl-4-(2-methyl-6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(3aS,4R,6R)-2,2-diethyl-4-(2-methyl-6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 136996904 |
| Molecular Formula | C16H25N4O14P3 |
| Molecular Weight | 590.31 g/mol |
| Exact Mass | 590.06 |
| IUPAC Name | [[(3aS,4R,6R)-2,2-diethyl-4-(2-methyl-6-oxo-1H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CCC1(CC)OC2[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n3cnc4c(=O)[nH]c(C)nc43)[C@H]2O1 |
| InChI | InChI=1S/C16H25N4O14P3/c1-4-16(5-2)31-11-9(6-29-36(25,26)34-37(27,28)33-35(22,23)24)30-15(12(11)32-16)20-7-17-10-13(20)18-8(3)19-14(10)21/h7,9,11-12,15H,4-6H2,1-3H3,(H,25,26)(H,27,28)(H,18,19,21)(H2,22,23,24)/t9-,11?,12+,15-/m1/s1 |
| InChIKey | KBHJEPXGCXUWGM-BWIWHEPQSA-N |
| XLogP | 0.97 |
| TPSA | 251.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|