C12H18N5O14P3 — CID 136594346
[[(1R,3R,4R,6R,7S)-3-(2-amino-6-oxo-1H-purin-9-yl)-7-hydroxy-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 136594346) has the molecular formula C12H18N5O14P3 and a molecular weight of 549.22 g/mol. Its IUPAC name is [[(1R,3R,4R,6R,7S)-3-(2-amino-6-oxo-1H-purin-9-yl)-7-hydroxy-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(1R,3R,4R,6R,7S)-3-(2-amino-6-oxo-1H-purin-9-yl)-7-hydroxy-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 136594346 |
| Molecular Formula | C12H18N5O14P3 |
| Molecular Weight | 549.22 g/mol |
| Exact Mass | 549.01 |
| IUPAC Name | [[(1R,3R,4R,6R,7S)-3-(2-amino-6-oxo-1H-purin-9-yl)-7-hydroxy-6-methyl-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@H]1O[C@H]2[C@H](n3cnc4c(=O)[nH]c(N)nc43)O[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]2O |
| InChI | InChI=1S/C12H18N5O14P3/c1-4-12(2-27-33(23,24)31-34(25,26)30-32(20,21)22)7(18)6(28-4)10(29-12)17-3-14-5-8(17)15-11(13)16-9(5)19/h3-4,6-7,10,18H,2H2,1H3,(H,23,24)(H,25,26)(H2,20,21,22)(H3,13,15,16,19)/t4-,6-,7+,10-,12+/m1/s1 |
| InChIKey | KMTVBTWYAFPZMC-BMWYYOBGSA-N |
| XLogP | -1.54 |
| TPSA | 288.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.22 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|