C10H13F3N5O12P3 — CID 136994272
[[(2S,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2,3,4-trifluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 136994272) has the molecular formula C10H13F3N5O12P3 and a molecular weight of 545.15 g/mol. Its IUPAC name is [[(2S,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2,3,4-trifluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2,3,4-trifluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 136994272 |
| Molecular Formula | C10H13F3N5O12P3 |
| Molecular Weight | 545.15 g/mol |
| Exact Mass | 544.97 |
| IUPAC Name | [[(2S,3S,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-2,3,4-trifluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@](F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](F)[C@H]2F)c(=O)[nH]1 |
| InChI | InChI=1S/C10H13F3N5O12P3/c11-3-5(12)10(13,1-27-32(23,24)30-33(25,26)29-31(20,21)22)28-8(3)18-2-15-4-6(18)16-9(14)17-7(4)19/h2-3,5,8H,1H2,(H,23,24)(H,25,26)(H2,20,21,22)(H3,14,16,17,19)/t3-,5+,8-,10-/m1/s1 |
| InChIKey | IREWASKCXGJKIX-HVDHTTBBSA-N |
| XLogP | -0.08 |
| TPSA | 258.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.15 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|