C10H14F2N5O12P3 — CID 137037258
[[5-(2-amino-6-oxo-1H-purin-9-yl)-2,3-difluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 137037258) has the molecular formula C10H14F2N5O12P3 and a molecular weight of 527.16 g/mol. Its IUPAC name is [[5-(2-amino-6-oxo-1H-purin-9-yl)-2,3-difluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-2,3-difluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 137037258 |
| Molecular Formula | C10H14F2N5O12P3 |
| Molecular Weight | 527.16 g/mol |
| Exact Mass | 526.98 |
| IUPAC Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-2,3-difluorooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2C2CC(F)C(F)(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14F2N5O12P3/c11-4-1-5(17-3-14-6-7(17)15-9(13)16-8(6)18)27-10(4,12)2-26-31(22,23)29-32(24,25)28-30(19,20)21/h3-5H,1-2H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,13,15,16,18) |
| InChIKey | OPIXEGVTVCORJL-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 258.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.16 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|